Benzoic acid,4-benzoyl-, methyl ester structure
|
Common Name | Benzoic acid,4-benzoyl-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 6158-54-9 | Molecular Weight | 240.25400 | |
| Density | 1.169g/cm3 | Boiling Point | 380ºC at 760 mmHg | |
| Molecular Formula | C15H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.8ºC | |
| Name | methyl 4-benzoylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 380ºC at 760 mmHg |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.25400 |
| Flash Point | 168.8ºC |
| Exact Mass | 240.07900 |
| PSA | 43.37000 |
| LogP | 2.70420 |
| Index of Refraction | 1.574 |
| InChIKey | UPXFXAMIFNGJLD-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(=O)c2ccccc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918300090 |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| p-benzoylbenzoic acid methyl ester |
| Benzoic acid,4-benzoyl-,methyl ester |
| 4-(methoxycarbonyl)-benzophenone |
| 4-methoxycarbonylphenyl phenyl ketone |
| 4-benzoyl-benzoic acid methyl ester |
| Methyl 4-benzophenonecarboxylate |
| Methyl p-benzoyl benzoate |
| 4-methoxycarbonylphenyl(phenyl)methanone |
| 4-Carbomethoxybenzophenone |
| Benzoic acid,p-benzoyl-,methyl ester |