(2-HYDROXYIMINO-2-PHENYL-ETHYL)-CARBAMICACIDTERT-BUTYLESTER structure
|
Common Name | (2-HYDROXYIMINO-2-PHENYL-ETHYL)-CARBAMICACIDTERT-BUTYLESTER | ||
|---|---|---|---|---|
| CAS Number | 61466-44-2 | Molecular Weight | 264.27900 | |
| Density | 1.23g/cm3 | Boiling Point | 421.9ºC at 760 mmHg | |
| Molecular Formula | C16H12N2O2 | Melting Point | 108-110ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 209ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2-hydroxyphenyl)-(1-phenylpyrazol-4-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 421.9ºC at 760 mmHg |
| Melting Point | 108-110ºC(lit.) |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.27900 |
| Flash Point | 209ºC |
| Exact Mass | 264.09000 |
| PSA | 55.12000 |
| LogP | 2.80890 |
| Index of Refraction | 1.639 |
| InChIKey | WTRJNEICFURGNX-UHFFFAOYSA-N |
| SMILES | O=C(c1cnn(-c2ccccc2)c1)c1ccccc1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933199090 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-hydroxyphenyl 1-phenylpyrazol-4-yl ketone |
| 1-phenyl-4-salicyloylpyrazole |
| MFCD00209592 |