4-(4-Methylphenoxy)benzaldehyde structure
|
Common Name | 4-(4-Methylphenoxy)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 61343-83-7 | Molecular Weight | 212.24400 | |
| Density | 1.129g/cm3 | Boiling Point | 333.7ºC at 760 mmHg | |
| Molecular Formula | C14H12O2 | Melting Point | 47-51ºC | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(4-Methylphenoxy)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 333.7ºC at 760 mmHg |
| Melting Point | 47-51ºC |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24400 |
| Flash Point | >230 °F |
| Exact Mass | 212.08400 |
| PSA | 26.30000 |
| LogP | 3.59980 |
| Index of Refraction | 1.599 |
| InChIKey | CKNIKWIWRIHFSJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Oc2ccc(C=O)cc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317-H319 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn,N |
| Risk Phrases | 22-36-43-51/53 |
| Safety Phrases | 26-36/37-61 |
| RIDADR | UN 3077 9/PG 3 |
| HS Code | 2912499000 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2912499000 |
|---|---|
| Summary | 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 4-(p-Tolyloxy)benzaldehyde |
| 4-(4'-methylphenoxy)benzaldehyde |
| 4-(4-tolyloxy)benzaldehyde |