cannabispiran structure
|
Common Name | cannabispiran | ||
|---|---|---|---|---|
| CAS Number | 61262-81-5 | Molecular Weight | 246.302 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 438.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.4±22.2 °C | |
| Name | 4-hydroxy-6-methoxyspiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 438.0±45.0 °C at 760 mmHg |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.302 |
| Flash Point | 166.4±22.2 °C |
| Exact Mass | 246.125595 |
| PSA | 46.53000 |
| LogP | 2.42 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | WSWHSHJDUZRVPR-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(c1)CCC21CCC(=O)CC1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914509090 |
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 7'-Hydroxy-5'-methoxy-2',3'-dihydro-4H-spiro[cyclohexane-1,1'-inden]-4-one |
| 2',3'-Dihydro-7'-hydroxy-5'-methoxyspiro(cyclohexane-1,1'-(1H)inden)-4-one |
| Spiro[cyclohexane-1,1'-[1H]inden]-4-one, 2',3'-dihydro-7'-hydroxy-5'-methoxy- |
| cannabispirane |
| cannabispirone |
| Cannabispiron |
| Cannabispiran |