CHEMBRDG-BB 7304721
Modify Date: 2025-11-30 18:38:24
CHEMBRDG-BB 7304721 structure
|
Common Name | CHEMBRDG-BB 7304721 | ||
|---|---|---|---|---|
| CAS Number | 6125-36-6 | Molecular Weight | 248.68700 | |
| Density | 1.471g/cm3 | Boiling Point | 435.9ºC at 760 mmHg | |
| Molecular Formula | C8H9ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.4ºC | |
| Name | methyl 2-[(2-chloroacetyl)amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.471g/cm3 |
|---|---|
| Boiling Point | 435.9ºC at 760 mmHg |
| Molecular Formula | C8H9ClN2O3S |
| Molecular Weight | 248.68700 |
| Flash Point | 217.4ºC |
| Exact Mass | 248.00200 |
| PSA | 96.53000 |
| LogP | 1.48840 |
| Index of Refraction | 1.626 |
| InChIKey | LERXBCQPIAOSSM-UHFFFAOYSA-N |
| SMILES | COC(=O)c1sc(NC(=O)CCl)nc1C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934100090 |
|
~%
CHEMBRDG-BB 7304721 CAS#:6125-36-6 |
| Literature: Indian Journal of Chemistry, , vol. 4, p. 33 - 36 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-Methyl-5-methoxycarbonyl-2-chloracetamino-thiazol |