2-phenyl-1-[4-(trifluoromethyl)phenyl]ethanone structure
|
Common Name | 2-phenyl-1-[4-(trifluoromethyl)phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 61062-55-3 | Molecular Weight | 264.24200 | |
| Density | 1.228g/cm3 | Boiling Point | 343.4ºC at 760mmHg | |
| Molecular Formula | C15H11F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.4ºC | |
| Name | 2-phenyl-1-[4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.228g/cm3 |
|---|---|
| Boiling Point | 343.4ºC at 760mmHg |
| Molecular Formula | C15H11F3O |
| Molecular Weight | 264.24200 |
| Flash Point | 175.4ºC |
| Exact Mass | 264.07600 |
| PSA | 17.07000 |
| LogP | 4.13080 |
| Index of Refraction | 1.523 |
| InChIKey | SOHDNUBGOFCYMP-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1)c1ccc(C(F)(F)F)cc1 |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-Phenyl-4'-trifluoromethylacetophenone |