(2-acetamidophenyl) 4-nitrobenzoate
Modify Date: 2025-11-25 19:21:51
(2-acetamidophenyl) 4-nitrobenzoate structure
|
Common Name | (2-acetamidophenyl) 4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 60949-48-6 | Molecular Weight | 300.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-acetamidophenyl) 4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H12N2O5 |
|---|---|
| Molecular Weight | 300.26600 |
| Exact Mass | 300.07500 |
| PSA | 104.71000 |
| LogP | 3.94510 |
| InChIKey | YMXRWAPIYHKECR-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccccc1OC(=O)c1ccc([N+](=O)[O-])cc1 |
|
~%
(2-acetamidophe... CAS#:60949-48-6 |
| Literature: Sakurai, Tadamitsu; Nagaoka, Tohru; Kamiya, Jun; Inoue, Hiroyasu Bulletin of the Chemical Society of Japan, 1996 , vol. 69, # 3 p. 775 - 778 |
| Acetamide,N-[2-[(4-nitrobenzoyl)oxy]phenyl] |
| o-Acetamidophenyl-p-nitrobenzoat |