2-ethoxyethyl 4-nitrobenzoate
Modify Date: 2025-08-23 18:37:42
2-ethoxyethyl 4-nitrobenzoate structure
|
Common Name | 2-ethoxyethyl 4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 37460-43-8 | Molecular Weight | 239.22500 | |
| Density | 1.226g/cm3 | Boiling Point | 338.6ºC at 760mmHg | |
| Molecular Formula | C11H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.1ºC | |
| Name | 2-ethoxyethyl 4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 338.6ºC at 760mmHg |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.22500 |
| Flash Point | 143.1ºC |
| Exact Mass | 239.07900 |
| PSA | 81.35000 |
| LogP | 2.31130 |
| Index of Refraction | 1.529 |
| InChIKey | JVKUSNIMTZCOMW-UHFFFAOYSA-N |
| SMILES | CCOCCOC(=O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2916399090 |
|---|
|
~%
2-ethoxyethyl 4... CAS#:37460-43-8 |
| Literature: Conn; Collett; Lazzell Journal of the American Chemical Society, 1932 , vol. 54, p. 4370 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Ethanol,2-ethoxy-,4-nitrobenzoate |
| 4-nitro-benzoic acid-(2-ethoxy-ethyl ester) |
| 4-Nitro-benzoesaeure-(2-aethoxy-aethylester) |