(E)-METHYL 4-(4-BROMOPHENYL)-2-OXOBUT-3-ENOATE structure
|
Common Name | (E)-METHYL 4-(4-BROMOPHENYL)-2-OXOBUT-3-ENOATE | ||
|---|---|---|---|---|
| CAS Number | 608128-34-3 | Molecular Weight | 269.09100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl (3E)-4-(4-bromophenyl)-2-oxo-3-butenoate |
|---|
| Molecular Formula | C11H9BrO3 |
|---|---|
| Molecular Weight | 269.09100 |
| Exact Mass | 267.97400 |
| PSA | 43.37000 |
| LogP | 2.20440 |
| InChIKey | OEKODHJXUIKZME-QPJJXVBHSA-N |
| SMILES | COC(=O)C(=O)C=Cc1ccc(Br)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918300090 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |