Dibutyl{[(trifluoromethyl)sulfonyl]oxy}borane
Modify Date: 2025-08-25 14:40:14
![Dibutyl{[(trifluoromethyl)sulfonyl]oxy}borane Structure](https://image.chemsrc.com/caspic/104/60669-69-4.png)
Dibutyl{[(trifluoromethyl)sulfonyl]oxy}borane structure
|
Common Name | Dibutyl{[(trifluoromethyl)sulfonyl]oxy}borane | ||
|---|---|---|---|---|
| CAS Number | 60669-69-4 | Molecular Weight | 274.109 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 249.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C9H18BF3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 104.6±30.1 °C | |
| Name | Dibutylboron trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 249.3±50.0 °C at 760 mmHg |
| Molecular Formula | C9H18BF3O3S |
| Molecular Weight | 274.109 |
| Flash Point | 104.6±30.1 °C |
| Exact Mass | 274.102173 |
| PSA | 51.75000 |
| LogP | 4.65 |
| Appearance of Characters | Solution | Clear light yellow to orange |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.394 |
| InChIKey | FAVAVMFXAKZTMV-UHFFFAOYSA-N |
| SMILES | CCCCB(CCCC)OS(=O)(=O)C(F)(F)F |
| Storage condition | 2-8°C |
| Hazard Codes | C,F+ |
|---|---|
| Risk Phrases | 12-22-34-66-67-40-10 |
| Safety Phrases | 9-16-26-33-36/37/39-45 |
| RIDADR | UN 2924 3/PG 1 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 3.2 |
| HS Code | 2931900090 |
|
~84%
Dibutyl{[(trifl... CAS#:60669-69-4 |
| Literature: Inoue, Tan; Mukaiyama, Teruaki Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 1 p. 174 - 178 |
CAS#:2403-22-7
CAS#:61829-43-4
CAS#:6281-00-1
CAS#:5441-81-6| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Dibutyl{[(trifluoromethyl)sulfonyl]oxy}borane |
| MFCD00009669 |
| dibutylboranyl trifluoromethanesulfonate |
| Borane, dibutyl[[(trifluoromethyl)sulfonyl]oxy]- |