dimethylaluminum i-propoxide
Modify Date: 2025-08-20 19:04:53
dimethylaluminum i-propoxide structure
|
Common Name | dimethylaluminum i-propoxide | ||
|---|---|---|---|---|
| CAS Number | 6063-89-4 | Molecular Weight | 116.13800 | |
| Density | 0.824 g/mL at 25ºC | Boiling Point | N/A | |
| Molecular Formula | C5H13AlO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5E)-1-(4-bromo-3-methylphenyl)-5-[(5-chloro-2-hydroxy-3-methoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 0.824 g/mL at 25ºC |
|---|---|
| Molecular Formula | C5H13AlO |
| Molecular Weight | 116.13800 |
| Exact Mass | 116.07800 |
| PSA | 9.23000 |
| LogP | 2.04330 |
| Appearance of Characters | liquid | colorless |
| Index of Refraction | 1.682 |
| InChIKey | MNMGIIHDFQDVBS-NTUHNPAUSA-N |
| SMILES | COc1cc(Cl)cc(C=C2C(=O)NC(=O)N(c3ccc(Br)c(C)c3)C2=O)c1O |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Dimethyl-aluminium-isopropylat |
| aluminium dimethylisopropoxide |
| MFCD07369026 |
| dimethylaluminum isopropoxide |