N-cyclohexyl-N-methoxy-2,5-dimethyl-3-furamide structure
|
Common Name | N-cyclohexyl-N-methoxy-2,5-dimethyl-3-furamide | ||
|---|---|---|---|---|
| CAS Number | 60568-05-0 | Molecular Weight | 251.32100 | |
| Density | 1.1g/cm3 | Boiling Point | 401.6ºC at 760 mmHg | |
| Molecular Formula | C14H21NO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >100ºC | |
| Symbol |
GHS08, GHS09 |
Signal Word | Warning | |
Use of N-cyclohexyl-N-methoxy-2,5-dimethyl-3-furamideFurmecyclox is an effective fungicide. Furmecyclox shows great effects against basidiomycetes[1]. |
| Name | furmecyclox |
|---|---|
| Synonym | More Synonyms |
| Description | Furmecyclox is an effective fungicide. Furmecyclox shows great effects against basidiomycetes[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Furmecyclox (0.1-10 μg/mL) effectively inhibits the germination of C. purpureum[1]. Furmecyclox (0.625-10 μg/mL) shows an effect on mycelial growth of C. purpureum[1]. Furmecyclox (100-500 μg/mL) slightly inhibits the mycelial development of T. viride[1]. |
| References |
[1]. https://www.tandfonline.com/doi/abs/10.1080/00221589.1983.11515147 |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 401.6ºC at 760 mmHg |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.32100 |
| Flash Point | >100ºC |
| Exact Mass | 251.15200 |
| PSA | 42.68000 |
| LogP | 3.23270 |
| Index of Refraction | 1.521 |
| InChIKey | QTDRLOKFLJJHTG-UHFFFAOYSA-N |
| SMILES | CON(C(=O)c1cc(C)oc1C)C1CCCCC1 |
| Storage condition | -20°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H351-H410 |
| Precautionary Statements | P273-P281-P501 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,N |
| Risk Phrases | 40-50/53 |
| Safety Phrases | 36/37-60-61 |
| RIDADR | UN3077 9/PG 3 |
| RTECS | LT9970000 |
| methyl N-cyclohexyl-2,5-dimethyl-3-furohydroxamate |
| methyl N-cyclohexyl-2,5-dimethylfuran-3-carbohydroxamate |
| BAS 389F |
| Epic |
| Caswell No. 907B |
| Epic Algaecide |
| Furmecyclox [BSI:ISO] |
| Campogran |
| N-cyclohexyl-N-methoxy-2,5-dimethylfuran-3-carboxamide |
| Furmetamide |
| Xyligen B |
| N-cyclohexyl-N-methoxy-2,5-dimethyl-3-furancarboxamide |
| N-Cyclohexyl-N-methoxy-2,5-dimethyl-3-furamide |
| Furmecyclox |