[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 2-iodobenzoate
Modify Date: 2025-09-18 14:23:37
![[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 2-iodobenzoate Structure](https://image.chemsrc.com/caspic/456/6052-90-0.png)
[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 2-iodobenzoate structure
|
Common Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 2-iodobenzoate | ||
|---|---|---|---|---|
| CAS Number | 6052-90-0 | Molecular Weight | 424.18700 | |
| Density | 1.668g/cm3 | Boiling Point | 556.6ºC at 760 mmHg | |
| Molecular Formula | C17H13IO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.4ºC | |
| Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] 2-iodobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.668g/cm3 |
|---|---|
| Boiling Point | 556.6ºC at 760 mmHg |
| Molecular Formula | C17H13IO5 |
| Molecular Weight | 424.18700 |
| Flash Point | 290.4ºC |
| Exact Mass | 423.98100 |
| PSA | 61.83000 |
| LogP | 3.10210 |
| Index of Refraction | 1.637 |
| InChIKey | MZNJCUWTHLMYKY-UHFFFAOYSA-N |
| SMILES | O=C(COC(=O)c1ccccc1I)c1ccc2c(c1)OCCO2 |
|
~%
[2-(2,3-dihydro... CAS#:6052-90-0 |
| Literature: Dianin Zhurnal Russkago Fiziko-Khimicheskago Obshchestva, 1891 , vol. 23, p. 503 Chemische Berichte, 25 Ref. <1892>, 335 |
|
~%
[2-(2,3-dihydro... CAS#:6052-90-0 |
| Literature: Reid; Wilson Journal of the American Chemical Society, 1944 , vol. 66, p. 967 |
| 2,2-Bis-(4-hydroxy-phenyl)-octan |
| 2,2-Bis(4-hydroxyphenyl)octane |
| 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl 2-iodobenzoate |