[1-(2-chloroethyl)piperidin-4-yl]-(4-fluorophenyl)methanone structure
|
Common Name | [1-(2-chloroethyl)piperidin-4-yl]-(4-fluorophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 60285-09-8 | Molecular Weight | 269.74200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17ClFNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [1-(2-chloroethyl)piperidin-4-yl]-(4-fluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H17ClFNO |
|---|---|
| Molecular Weight | 269.74200 |
| Exact Mass | 269.09800 |
| PSA | 20.31000 |
| LogP | 2.89710 |
| InChIKey | UJQXEDGDZCOECV-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)cc1)C1CCN(CCCl)CC1 |
|
~65%
[1-(2-chloroeth... CAS#:60285-09-8 |
| Literature: Adir et Compagnie Patent: US5387586 A1, 1995 ; |
|
~76%
[1-(2-chloroeth... CAS#:60285-09-8 |
| Literature: Comoy, Corinne; Guerin, Virginie; Pfeiffer, Bruno; Rettori, Marie-Claire; Renard, Pierre; Guillaumet, Gerald Bioorganic and Medicinal Chemistry, 2000 , vol. 8, # 3 p. 483 - 495 |
|
~%
[1-(2-chloroeth... CAS#:60285-09-8 |
| Literature: Adir et Compagnie Patent: US5077288 A1, 1991 ; |
|
~%
[1-(2-chloroeth... CAS#:60285-09-8 |
| Literature: Comoy, Corinne; Guerin, Virginie; Pfeiffer, Bruno; Rettori, Marie-Claire; Renard, Pierre; Guillaumet, Gerald Bioorganic and Medicinal Chemistry, 2000 , vol. 8, # 3 p. 483 - 495 |
| 1-(2-chloroethyl)-4-(p-fluorobenzoyl)piperidine |
| 1-(2-chloroethyl)-4-(4-fluorobenzoyl)piperidine |
| Methanone,[1-(2-chloroethyl)-4-piperidinyl](4-fluorophenyl) |
| 2-[4-(4-fluorobenzoyl)piperidino]ethyl chloride |