Skyrin structure
|
Common Name | Skyrin | ||
|---|---|---|---|---|
| CAS Number | 602-06-2 | Molecular Weight | 538.458 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 956.1±65.0 °C at 760 mmHg | |
| Molecular Formula | C30H18O10 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 545.8±30.8 °C | |
Use of SkyrinSkyrin is a fungal metabolite characterized by a bisanthraquinone structure. |
| Name | 2,4,5-trihydroxy-7-methyl-1-(2,4,5-trihydroxy-7-methyl-9,10-dioxoanthracen-1-yl)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 956.1±65.0 °C at 760 mmHg |
| Molecular Formula | C30H18O10 |
| Molecular Weight | 538.458 |
| Flash Point | 545.8±30.8 °C |
| Exact Mass | 538.090027 |
| PSA | 189.66000 |
| LogP | 8.91 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.808 |
| InChIKey | MQSXZQXHIJMNAF-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c2c(c1)C(=O)c1c(c(O)cc(O)c1-c1c(O)cc(O)c3c1C(=O)c1cc(C)cc(O)c1C3=O)C2=O |
| Safety Phrases | 22-24/25 |
|---|---|
| RIDADR | NONH for all modes of transport |
|
~%
Skyrin CAS#:602-06-2 |
| Literature: Franck; Stange 1981 , vol. No. 12, p. 2106 - 2116 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Transformations of Penicillium islandicum and Penicillium frequentans that produce anthraquinone-related compounds.
Curr. Genet. 28(6) , 580-4, (1995) Wild-type strains of Penicillium islandicum and Penicillium frequentans, which produce anthraquinone and related compounds, were transformed to benomyl and hygromycin B resistance. Plasmids pSV50 and ... |
|
|
Progress in the chemistry of organic natural products. The chemistry of mycotoxins.
Fortschr. Chem. Org. Naturst. 97 , v-xv, 1-300, (2013)
|
|
|
Mutagenicity of substituted anthraquinones in the Ames/Salmonella microsome system.
Mutat. Res. 279(1) , 1-8, (1992) Unsubstituted anthraquinone, 4 substituted anthraquinones (emodin, danthron, physcion, a new compound M-108-C) and 3 dimers (skyrin, rugulosin, rugulin) were tested using the Ames/Salmonella assay (st... |
| stemphyperylenol |
| 2,4,5,2',4',5'-Hexahydroxy-7,7'-dimethyl-[1,1']bianthryl-9,10,9',10'-tetraon |
| Endothianin |
| 2,2',4,4',5,5'-Hexahydroxy-7,7'-dimethyl-1,1'-bianthracene-9,9',10,10'-tetrone |
| UNII:VLA1F42GXP |
| Skyrin |
| [1,1'-Bianthracene]-9,9',10,10'-tetrone, 2,2',4,4',5,5'-hexahydroxy-7,7'-dimethyl- |
| 2,4,5,2',4',5'-hexahydroxy-7,7'-dimethyl-[1,1']bianthryl-9,10,9',10'-tetraone |
| (1,1'-Bianthracene)-9,9',10,10'-tetrone,2,2',4,4',5,5'-hexahydroxy-7,7'-dimethyl-,(S) |