Methyldopate
Modify Date: 2025-08-27 11:59:52
Methyldopate structure
|
Common Name | Methyldopate | ||
|---|---|---|---|---|
| CAS Number | 6014-30-8 | Molecular Weight | 239.268 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 398.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.5±26.5 °C | |
Use of MethyldopateMethyldopate is an ethyl ester prodrug of α-Methyldopa (α-MD; HY-B0225). Methyldopa (L-(-)-α-Methyldopa) is an α-adrenergic agonist (selective for α2-adrenergic receptors). Methyldopate has the potential for severe hypertension research [1]. |
| Name | Methyldopate |
|---|---|
| Synonym | More Synonyms |
| Description | Methyldopate is an ethyl ester prodrug of α-Methyldopa (α-MD; HY-B0225). Methyldopa (L-(-)-α-Methyldopa) is an α-adrenergic agonist (selective for α2-adrenergic receptors). Methyldopate has the potential for severe hypertension research [1]. |
|---|---|
| Related Catalog | |
| In Vivo | Methyldopate is hydrolysed in vivo to methyldopa[2]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 398.0±37.0 °C at 760 mmHg |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.268 |
| Flash Point | 194.5±26.5 °C |
| Exact Mass | 239.115753 |
| LogP | 0.81 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | SVEBYYWCXTVYCR-LBPRGKRZSA-N |
| SMILES | CCOC(=O)C(C)(N)Cc1ccc(O)c(O)c1 |
| Ethyl 3-hydroxy-α-methyl-L-tyrosinate |
| Alanine, 3-(3,4-dihydroxyphenyl)-2-methyl-, ethyl ester, L- |
| L-Methyldopa ethyl ester |
| 3-Hydroxy-a-methyl-L-tyrosine Ethyl Ester |
| MFCD00865839 |
| L-3-(3,4-Dihydroxyphenyl)-2-methylalanine ethyl ester |
| EINECS 219-720-3 |
| 2579Z4P04J |
| L-Tyrosine, 3-hydroxy-α-methyl-, ethyl ester |
| EINECS 219-821-2 |
| Methyldopate |
| L-Methyldopate |