Methyldopate hydrochloride
Modify Date: 2024-01-02 15:02:35
Methyldopate hydrochloride structure
|
Common Name | Methyldopate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2508-79-4 | Molecular Weight | 275.72900 | |
| Density | 1.243g/cm3 | Boiling Point | 398ºC at 760 mmHg | |
| Molecular Formula | C12H18ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.5ºC | |
Use of Methyldopate hydrochlorideMethyldopate hydrochloride is an ethyl ester hydrochloride prodrug of α-Methyldopa (α-MD; HY-B0225). Methyldopa (L-(-)-α-Methyldopa) is an α-adrenergic agonist (selective for α2-adrenergic receptors). Methyldopate hydrochloride has the potential for severe hypertension research[1]. |
| Name | ethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Methyldopate hydrochloride is an ethyl ester hydrochloride prodrug of α-Methyldopa (α-MD; HY-B0225). Methyldopa (L-(-)-α-Methyldopa) is an α-adrenergic agonist (selective for α2-adrenergic receptors). Methyldopate hydrochloride has the potential for severe hypertension research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 398ºC at 760 mmHg |
| Molecular Formula | C12H18ClNO4 |
| Molecular Weight | 275.72900 |
| Flash Point | 194.5ºC |
| Exact Mass | 275.09200 |
| PSA | 92.78000 |
| LogP | 2.42310 |
| Vapour Pressure | 6.62E-07mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | QSRVZCCJDKYRRF-YDALLXLXSA-N |
| SMILES | CCOC(=O)C(C)(N)Cc1ccc(O)c(O)c1.Cl |
| METHYLDOPATE HYDROCHLORIDE |
| Methyldopa ethyl hydrochloride |
| EINECS 219-720-3 |
| Methyldopa ethyl ester hydrochloride |
| UNII-7PX435DN5A |