Propanediamide,N1,N3-bis(3,4-dichlorophenyl)-2-methyl-
Modify Date: 2025-09-28 23:43:58
Propanediamide,N1,N3-bis(3,4-dichlorophenyl)-2-methyl- structure
|
Common Name | Propanediamide,N1,N3-bis(3,4-dichlorophenyl)-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 60131-77-3 | Molecular Weight | 406.09100 | |
| Density | 1.534g/cm3 | Boiling Point | 628.3ºC at 760 mmHg | |
| Molecular Formula | C16H12Cl4N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 333.8ºC | |
| Name | N,N'-bis(3,4-dichlorophenyl)-2-methylpropanediamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.534g/cm3 |
|---|---|
| Boiling Point | 628.3ºC at 760 mmHg |
| Molecular Formula | C16H12Cl4N2O2 |
| Molecular Weight | 406.09100 |
| Flash Point | 333.8ºC |
| Exact Mass | 403.96500 |
| PSA | 58.20000 |
| LogP | 5.65950 |
| Index of Refraction | 1.667 |
| InChIKey | YYQKVOHHNIZZRC-UHFFFAOYSA-N |
| SMILES | CC(C(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
|
~37%
Propanediamide,... CAS#:60131-77-3 |
| Literature: Kappe, Thomas; Karem, Abdel S.; Stadlbauer, Wolfgang Journal of Heterocyclic Chemistry, 1988 , vol. 25, p. 857 - 862 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N'-bis-(3,4-dichlorophenyl)methylmalonamide |