perfluoromethyladamantane structure
|
Common Name | perfluoromethyladamantane | ||
|---|---|---|---|---|
| CAS Number | 60096-00-6 | Molecular Weight | 474.08900 | |
| Density | 1.89g/cm3 | Boiling Point | 126.9ºC at 760 mmHg | |
| Molecular Formula | C11F18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 40.4ºC | |
| Name | perfluoro-1-methyladamantane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.89g/cm3 |
|---|---|
| Boiling Point | 126.9ºC at 760 mmHg |
| Molecular Formula | C11F18 |
| Molecular Weight | 474.08900 |
| Flash Point | 40.4ºC |
| Exact Mass | 473.97100 |
| LogP | 5.51260 |
| Index of Refraction | 1.316 |
| InChIKey | WKHMXCIUCCIPOU-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C12C(F)(F)C3(F)C(F)(F)C(F)(C(F)(F)C(F)(C3(F)F)C1(F)F)C2(F)F |
|
~%
perfluoromethyl... CAS#:60096-00-6 |
| Literature: Moore,R.E.; Driscoll,G.L. Journal of Organic Chemistry, 1978 , vol. 43, p. 4978 - 4980 |
| Perfluoromethyladamantane |
| 1,2,2,3,4,4,5,6,6,8,8,9,9,10,10-pentadecafluoro-7-(trifluoromethyl)adamantane |
| F-MA |
| 1,2,2,3,4,4,5,6,6,8,8,9,9,10,10-pentadecafluoro-7-(trifluoromethyl)tricyclo[3.3.1.1(3,7)]decane |
| Perfluoro(1-methyladamantane) |