Isopropyl[3-(p-iodophenyl)butyl] =carbonate structure
|
Common Name | Isopropyl[3-(p-iodophenyl)butyl] =carbonate | ||
|---|---|---|---|---|
| CAS Number | 60075-83-4 | Molecular Weight | 362.20300 | |
| Density | 1.424g/cm3 | Boiling Point | 367.7ºC at 760 mmHg | |
| Molecular Formula | C14H19IO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.2ºC | |
| Name | 3-(4-iodophenyl)butyl propan-2-yl carbonate |
|---|
| Density | 1.424g/cm3 |
|---|---|
| Boiling Point | 367.7ºC at 760 mmHg |
| Molecular Formula | C14H19IO3 |
| Molecular Weight | 362.20300 |
| Flash Point | 176.2ºC |
| Exact Mass | 362.03800 |
| PSA | 35.53000 |
| LogP | 4.34640 |
| Index of Refraction | 1.541 |
| InChIKey | BWRLYESNWMEAGD-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)OCCC(C)c1ccc(I)cc1 |
| HS Code | 2920909090 |
|---|
|
~%
Isopropyl[3-(p-... CAS#:60075-83-4 |
| Literature: Newton,B.N. Journal of Medicinal Chemistry, 1976 , vol. 19, p. 1362 - 1366 |
|
~%
Isopropyl[3-(p-... CAS#:60075-83-4 |
| Literature: Newton,B.N. Journal of Medicinal Chemistry, 1976 , vol. 19, p. 1362 - 1366 |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |