Hexyl[3-(p-iodophenyl)propyl] =carbonate structure
|
Common Name | Hexyl[3-(p-iodophenyl)propyl] =carbonate | ||
|---|---|---|---|---|
| CAS Number | 60075-80-1 | Molecular Weight | 390.25600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23IO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | hexyl 3-(4-iodophenyl)propyl carbonate |
|---|
| Molecular Formula | C16H23IO3 |
|---|---|
| Molecular Weight | 390.25600 |
| Exact Mass | 390.06900 |
| PSA | 35.53000 |
| LogP | 4.95730 |
| InChIKey | KQOKRJDDYJLNCW-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)OCCCc1ccc(I)cc1 |
| HS Code | 2920909090 |
|---|
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |