5-[(4-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione
Modify Date: 2025-08-27 00:03:25
![5-[(4-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione Structure](https://image.chemsrc.com/caspic/330/60045-61-6.png)
5-[(4-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione structure
|
Common Name | 5-[(4-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione | ||
|---|---|---|---|---|
| CAS Number | 60045-61-6 | Molecular Weight | 262.28400 | |
| Density | 1.42g/cm3 | Boiling Point | 467.2ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.4ºC | |
| Name | 5-[(4-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 467.2ºC at 760 mmHg |
| Molecular Formula | C12H10N2O3S |
| Molecular Weight | 262.28400 |
| Flash Point | 236.4ºC |
| Exact Mass | 262.04100 |
| PSA | 99.52000 |
| LogP | 1.26710 |
| Index of Refraction | 1.669 |
| InChIKey | ZTXJEYAMFKSOIY-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=C2C(=O)NC(=S)NC2=O)cc1 |
| HS Code | 2933599090 |
|---|
|
~98%
5-[(4-methoxyph... CAS#:60045-61-6 |
| Literature: Hu, Yi; Chen, Zhen-Chu; Le, Zhang-Gao; Zheng, Qin-Guo Synthetic Communications, 2004 , vol. 34, # 24 p. 4521 - 4529 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(4-methoxybenzylidene)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione |
| 5-(4-methoxybenzylidene)-2-thioxo-2,3-dihydro-(1H,5H)-pyrimidine-4,6-dione |
| 5-(4-methoxybenzylidene)-2-thiobarbituric acid |
| 5-p-Methoxybenzylidene-2-thiobarbituric acid |
| 5-(4-methoxyphenyl)methylenethiobarbituric acid |
| 5-[(4'-methoxyphenyl)methylidene]-2-thioxodihydropyrimidine-4,6(1H,5H)-dione |