Pyrimido[4,5-b]quinoline-2,4(3H,10H)-dione, 10-butyl- structure
|
Common Name | Pyrimido[4,5-b]quinoline-2,4(3H,10H)-dione, 10-butyl- | ||
|---|---|---|---|---|
| CAS Number | 59997-19-2 | Molecular Weight | 269.29900 | |
| Density | 1.33g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 10-butylpyrimido[4,5-b]quinoline-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.29900 |
| Exact Mass | 269.11600 |
| PSA | 67.75000 |
| LogP | 2.03810 |
| Index of Refraction | 1.669 |
| InChIKey | RBQQKCAJWKVRDN-UHFFFAOYSA-N |
| SMILES | CCCCn1c2nc(=O)[nH]c(=O)c-2cc2ccccc21 |
|
~88%
Pyrimido[4,5-b]... CAS#:59997-19-2 |
| Literature: Kanaoka, Yoshitomo; Ikeuchi, Yoshihiro; Kawamoto, Tetsuji; Bessho, Kiyoshi; Akimoto, Naoshige; Mikata, Yuji; Nishida, Mamiko; Yano, Shigenobu; Sasaki, Takuma; Yoneda, Fumio Bioorganic and Medicinal Chemistry, 1998 , vol. 6, # 3 p. 301 - 314 |
|
~78%
Pyrimido[4,5-b]... CAS#:59997-19-2 |
| Literature: Nagamatsu, Tomohisa; Hashiguchi, Yuko; Yoneda, Fumio Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 3 p. 561 - 565 |
|
~77%
Pyrimido[4,5-b]... CAS#:59997-19-2 |
| Literature: Nagamatsu, Tomohisa; Hashiguchi, Yuko; Yoneda, Fumio Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 3 p. 561 - 565 |
| Pyrimido[4,5-b]quinoline-2,4(3H,10H)-dione,10-butyl |
| 10-butyl-10H-pyrimido[4,5-b]quinoline-2,4-dione |