2,4(1H,3H)-Pyrimidinedione,6-(butylamino)- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,6-(butylamino)- | ||
|---|---|---|---|---|
| CAS Number | 28484-86-8 | Molecular Weight | 183.20800 | |
| Density | 1.19g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(butylamino)-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.20800 |
| Exact Mass | 183.10100 |
| PSA | 77.75000 |
| LogP | 0.34820 |
| Index of Refraction | 1.538 |
| InChIKey | VTYJBXCNELPXNP-UHFFFAOYSA-N |
| SMILES | CCCCNc1cc(=O)[nH]c(=O)[nH]1 |
|
~81%
2,4(1H,3H)-Pyri... CAS#:28484-86-8 |
| Literature: Wright; Brown Journal of Medicinal Chemistry, 1980 , vol. 23, # 1 p. 34 - 38 |
| 6-butylaminouracil |
| 6-butylamino-1H-pyrimidine-2,4-dione |