Exisulind
Modify Date: 2025-08-27 18:19:49
Exisulind structure
|
Common Name | Exisulind | ||
|---|---|---|---|---|
| CAS Number | 59973-80-7 | Molecular Weight | 372.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H17FO4S | Melting Point | 248-250ºC | |
| MSDS | Chinese | Flash Point | N/A | |
Use of ExisulindSulindac sulfone is an mTORC1 pathway inhibitor and a metabolite of Sulindac. Sulindac sulfone inhibits colon cancer cell growth and induces cell cycle arrest. Sulindac sulfone is used in cancer research[1]. |
| Name | sulindac sulfone |
|---|---|
| Synonym | More Synonyms |
| Description | Sulindac sulfone is an mTORC1 pathway inhibitor and a metabolite of Sulindac. Sulindac sulfone inhibits colon cancer cell growth and induces cell cycle arrest. Sulindac sulfone is used in cancer research[1]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 248-250ºC |
|---|---|
| Molecular Formula | C20H17FO4S |
| Molecular Weight | 372.41 |
| Exact Mass | 372.08300 |
| PSA | 79.82000 |
| LogP | 5.11240 |
| InChIKey | MVGSNCBCUWPVDA-MFOYZWKCSA-N |
| SMILES | CC1=C(CC(=O)O)c2cc(F)ccc2C1=Cc1ccc(S(C)(=O)=O)cc1 |
| Storage condition | -20°C |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-[(3Z)-6-fluoro-2-methyl-3-[(4-methylsulfonylphenyl)methylidene]inden-1-yl]acetic acid |
| Sulindac Sulfone |