6-BROMO-7-NITRO-2,3-DIHYDROBENZO[B][1,4]DIOXINE structure
|
Common Name | 6-BROMO-7-NITRO-2,3-DIHYDROBENZO[B][1,4]DIOXINE | ||
|---|---|---|---|---|
| CAS Number | 59820-92-7 | Molecular Weight | 260.04200 | |
| Density | 1.776 g/cm3 | Boiling Point | 311.9ºC at 760 mmHg | |
| Molecular Formula | C8H6BrNO4 | Melting Point | 171.9-172.1 °C | |
| MSDS | N/A | Flash Point | 142.4ºC | |
| Name | 6-Bromo-7-nitrobenzo(1,4)dioxan |
|---|---|
| Synonym | More Synonyms |
| Density | 1.776 g/cm3 |
|---|---|
| Boiling Point | 311.9ºC at 760 mmHg |
| Melting Point | 171.9-172.1 °C |
| Molecular Formula | C8H6BrNO4 |
| Molecular Weight | 260.04200 |
| Flash Point | 142.4ºC |
| Exact Mass | 258.94800 |
| PSA | 64.28000 |
| LogP | 2.65170 |
| Index of Refraction | 1.617 |
| InChIKey | PBFAMONJVJBDQV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc2c(cc1Br)OCCO2 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2932999099 |
|
~%
6-BROMO-7-NITRO... CAS#:59820-92-7 |
| Literature: Journal of the Chemical Society, , p. 18,21 |
|
~%
6-BROMO-7-NITRO... CAS#:59820-92-7 |
| Literature: Journal of the Chemical Society, , p. 18,21 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-bromo-7-nitro-2,3-dihydro-1,4-benzodioxine |