1-chloro-4-hydroxythioxanthen-9-one structure
|
Common Name | 1-chloro-4-hydroxythioxanthen-9-one | ||
|---|---|---|---|---|
| CAS Number | 59803-22-4 | Molecular Weight | 262.71100 | |
| Density | 1.523g/cm3 | Boiling Point | 426.4ºC at 760 mmHg | |
| Molecular Formula | C13H7ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.7ºC | |
| Name | 1-chloro-4-hydroxythioxanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.523g/cm3 |
|---|---|
| Boiling Point | 426.4ºC at 760 mmHg |
| Molecular Formula | C13H7ClO2S |
| Molecular Weight | 262.71100 |
| Flash Point | 211.7ºC |
| Exact Mass | 261.98600 |
| PSA | 65.54000 |
| LogP | 3.77370 |
| Index of Refraction | 1.73 |
| InChIKey | CHVNGPFOOJHLLJ-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2sc2c(O)ccc(Cl)c12 |
|
~99%
1-chloro-4-hydr... CAS#:59803-22-4 |
| Literature: AGFA-GEVAERT; LOCCUFIER, Johan Patent: WO2012/52288 A1, 2012 ; Location in patent: Page/Page column 43-44 ; |
|
~90%
1-chloro-4-hydr... CAS#:59803-22-4 |
| Literature: Palmeira, Andreia; Vasconcelos, M. Helena; Paiva, Ana; Fernandes, Miguel X.; Pinto, Madalena; Sousa, Emilia Biochemical Pharmacology, 2012 , vol. 83, # 1 p. 57 - 68 |
|
~38%
1-chloro-4-hydr... CAS#:59803-22-4 |
| Literature: Archer; Miller; Rej; Periana; Fricker Journal of Medicinal Chemistry, 1982 , vol. 25, # 3 p. 220 - 227 |
| 1-chloro-4-hydroxy-thioxanthen-9-one |
| 9H-Thioxanthen-9-one,1-chloro-4-hydroxy |
| 1-chloro-4-hydroxythioxanthenone |
| 1-chloro-4-hydroxythioxanthone |
| 1-Chlor-4-hydroxy-thioxanthen-9-on |
| 1-chloro-4-hydroxy-9H-thioxanthen-9-one |