Teroxirone
Modify Date: 2025-09-05 11:10:53
Teroxirone structure
|
Common Name | Teroxirone | ||
|---|---|---|---|---|
| CAS Number | 59653-73-5 | Molecular Weight | 584.82624 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H56O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TeroxironeTeroxirone, also known as Triglycidyl Isocyanurate and Tris(2,3-epoxypropyl) Isocyanurate, is a triazene triepoxide with antineoplastic activity. Teroxine alkylates and cross-links DNA, thereby inhibiting DNA replication. |
| Name | Teroxirone |
|---|
| Molecular Formula | C36H56O6 |
|---|---|
| Molecular Weight | 584.82624 |
| InChIKey | OUPZKGBUJRBPGC-HLTSFMKQSA-N |
| SMILES | O=c1n(CC2CO2)c(=O)n(CC2CO2)c(=O)n1CC1CO1 |