(2-methyl-3-nitrophenyl)-phenylmethanone
Modify Date: 2025-08-26 14:42:34
(2-methyl-3-nitrophenyl)-phenylmethanone structure
|
Common Name | (2-methyl-3-nitrophenyl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 59394-73-9 | Molecular Weight | 241.24200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-methyl-3-nitrophenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11NO3 |
|---|---|
| Molecular Weight | 241.24200 |
| Exact Mass | 241.07400 |
| PSA | 62.89000 |
| LogP | 3.65740 |
| InChIKey | CMGBMDFPBWVRMC-UHFFFAOYSA-N |
| SMILES | Cc1c(C(=O)c2ccccc2)cccc1[N+](=O)[O-] |
|
~96%
(2-methyl-3-nit... CAS#:59394-73-9 |
| Literature: Bison-werke Bahre and Greten GmbH and Co. KG Patent: US4065477 A1, 1977 ; |
|
~71%
(2-methyl-3-nit... CAS#:59394-73-9 |
| Literature: Astoin; Lepage; Fromantin European Journal of Medicinal Chemistry, 1980 , vol. 15, # 5 p. 457 - 462 |
| 2-methyl-3-nitrobenzophenone |
| Methanone,(2-methyl-3-nitrophenyl)phenyl |