(2-methyl-3-nitrophenyl)hydrazine,hydrochloride
Modify Date: 2025-10-20 14:06:49
(2-methyl-3-nitrophenyl)hydrazine,hydrochloride structure
|
Common Name | (2-methyl-3-nitrophenyl)hydrazine,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 412925-91-8 | Molecular Weight | 203.62600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H10ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-methyl-3-nitrophenyl)hydrazine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H10ClN3O2 |
|---|---|
| Molecular Weight | 203.62600 |
| Exact Mass | 203.04600 |
| PSA | 83.87000 |
| LogP | 3.28730 |
| InChIKey | OFXAVZNTUBSHEB-UHFFFAOYSA-N |
| SMILES | Cc1c(NN)cccc1[N+](=O)[O-].Cl |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1-(2-methyl-3-nitrophenyl)hydrazine hydrochloride |