3,4,5-trimethoxybenzaldehyde dimethyl acetal structure
|
Common Name | 3,4,5-trimethoxybenzaldehyde dimethyl acetal | ||
|---|---|---|---|---|
| CAS Number | 59276-37-8 | Molecular Weight | 242.26800 | |
| Density | 1.147 g/mL at 25ºC(lit.) | Boiling Point | 292.3ºC at 760 mmHg | |
| Molecular Formula | C12H18O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 111.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-(dimethoxymethyl)-1,2,3-trimethoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.147 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 292.3ºC at 760 mmHg |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.26800 |
| Flash Point | 111.1ºC |
| Exact Mass | 242.11500 |
| PSA | 46.15000 |
| LogP | 2.00380 |
| Index of Refraction | n20/D 1.514(lit.) |
| InChIKey | PEZMUQHWXSFOIK-UHFFFAOYSA-N |
| SMILES | COc1cc(C(OC)OC)cc(OC)c1OC |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
|
Synthesis of antibiotic stilbenes by reductive metalation of 3,4,5-trimethoxybenzaldehyde dimethyl acetal. Azzena U, et al.
Synth. Commun. 33(8) , 1309-1317, (2003)
|
| MFCD01321359 |
| 3,4,5-trimethoxy-benzaldehyde dimethyl acetal |