2-(2-bromo-4-chloro-6-formylphenoxy)acetic acid
Modify Date: 2025-08-25 17:54:15
2-(2-bromo-4-chloro-6-formylphenoxy)acetic acid structure
|
Common Name | 2-(2-bromo-4-chloro-6-formylphenoxy)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 590395-61-2 | Molecular Weight | 293.49900 | |
| Density | 1.785g/cm3 | Boiling Point | 427.1ºC at 760 mmHg | |
| Molecular Formula | C9H6BrClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.1ºC | |
| Name | 2-(2-bromo-4-chloro-6-formylphenoxy)acetic acid |
|---|
| Density | 1.785g/cm3 |
|---|---|
| Boiling Point | 427.1ºC at 760 mmHg |
| Molecular Formula | C9H6BrClO4 |
| Molecular Weight | 293.49900 |
| Flash Point | 212.1ºC |
| Exact Mass | 291.91400 |
| PSA | 63.60000 |
| LogP | 2.37840 |
| Index of Refraction | 1.629 |
| InChIKey | YBVLVKIVYCMFOO-UHFFFAOYSA-N |
| SMILES | O=Cc1cc(Cl)cc(Br)c1OCC(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |