2-(2-Bromo-4,6-dichlorophenoxy)acetic acid
Modify Date: 2025-11-26 22:59:09
2-(2-Bromo-4,6-dichlorophenoxy)acetic acid structure
|
Common Name | 2-(2-Bromo-4,6-dichlorophenoxy)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 103951-16-2 | Molecular Weight | 299.93400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5BrCl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-Bromo-4,6-dichlorophenoxy)acetic acid |
|---|
| Molecular Formula | C8H5BrCl2O3 |
|---|---|
| Molecular Weight | 299.93400 |
| Exact Mass | 297.88000 |
| PSA | 46.53000 |
| LogP | 3.21930 |
| InChIKey | VILOYBNGPGKGET-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1c(Cl)cc(Cl)cc1Br |
| HS Code | 2918990090 |
|---|
|
~%
2-(2-Bromo-4,6-... CAS#:103951-16-2 |
| Literature: Toothill et al. Annals of Applied Biology, 1956 , vol. 44, p. 547,549, 550 |
|
~%
2-(2-Bromo-4,6-... CAS#:103951-16-2 |
| Literature: Knopp; Nuhn; Mittag Pharmazie, 1986 , vol. 41, # 2 p. 143 - 143 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |