3-cyclohexyl-4-prop-2-enyl-1H-1,2,4-triazole-5-thione structure
|
Common Name | 3-cyclohexyl-4-prop-2-enyl-1H-1,2,4-triazole-5-thione | ||
|---|---|---|---|---|
| CAS Number | 590376-61-7 | Molecular Weight | 223.33800 | |
| Density | 1.23g/cm3 | Boiling Point | 302.3ºC at 760 mmHg | |
| Molecular Formula | C11H17N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.6ºC | |
| Name | 3-cyclohexyl-4-prop-2-enyl-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 302.3ºC at 760 mmHg |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.33800 |
| Flash Point | 136.6ºC |
| Exact Mass | 223.11400 |
| PSA | 69.51000 |
| LogP | 2.80050 |
| Index of Refraction | 1.643 |
| InChIKey | BCLVTKWIMAUZQF-UHFFFAOYSA-N |
| SMILES | C=CCn1c(C2CCCCC2)n[nH]c1=S |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-allyl-5-cyclohexyl-4H-1,2,4-triazole-3-thiol |
| 5-cyclohexyl-4-(prop-2-en-1-yl)-4H-1,2,4-triazole-3-thiol |