(S)-(+)-Dihydro-5-(p tolylsulfonyloxymethyl)-2(3H)-fu ranone structure
|
Common Name | (S)-(+)-Dihydro-5-(p tolylsulfonyloxymethyl)-2(3H)-fu ranone | ||
|---|---|---|---|---|
| CAS Number | 58879-34-8 | Molecular Weight | 270.30200 | |
| Density | 1.311g/cm3 | Boiling Point | 476.5ºC at 760 mmHg | |
| Molecular Formula | C12H14O5S | Melting Point | 86-88ºC | |
| MSDS | Chinese USA | Flash Point | 242ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (S)-(5-Oxotetrahydrofuran-2-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.311g/cm3 |
|---|---|
| Boiling Point | 476.5ºC at 760 mmHg |
| Melting Point | 86-88ºC |
| Molecular Formula | C12H14O5S |
| Molecular Weight | 270.30200 |
| Flash Point | 242ºC |
| Exact Mass | 270.05600 |
| PSA | 78.05000 |
| LogP | 2.48670 |
| Index of Refraction | 1.542 |
| InChIKey | MGAXYKDBRBNWKT-JTQLQIEISA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCC(=O)O2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2932190090 |
| Precursor 9 | |
|---|---|
| DownStream 7 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (S)-(+)-Dihydro-5-(p-tolysulfonyioxymethyl)-2-(3H)-furanone |
| (S)-(+)-Toluenesulfonylmethyl)--butyrolactone |
| (S)-(+)-DIHYDRO-5-(P-TOLYLSULFONYLOXYMETHYL)-2(3H)-FURANONE |
| toluene-4-sulfonic acid (S)-5-oxo-tetrahydro-furan-2-ylmethyl ester |
| (5S)-(+)-dihydro-5-(p-tolylsulfonyloxymethyl)-2(3H)-furanone |
| (S)-(+)-5-(4-Toluolsulfonyloxy)-methyl-4,5-dihydro-2(3H)-furanon |
| (S)-(+)-Dihydro-5-(4-tolylsulfonyloxymethyl)-2(3H)-furanone |
| 5-O-p-toluenesulfonyl-2,3-dideoxy-D-glycero-pentono-1,4-lactone |
| (S)-(+)-g-Toluenesulfonylmethyl-g-butyrolactone. |
| (2S)-toluene-4-sulfonic acid 5-oxo-tetrahydro-furan-2-ylmethyl ester |
| [(2S)-5-oxotetrahydrofuran-2-yl]methyl 4-methylbenzenesulfonate |
| MFCD00082548 |