ART-CHEM-BB B018007
Modify Date: 2025-09-12 17:06:31
ART-CHEM-BB B018007 structure
|
Common Name | ART-CHEM-BB B018007 | ||
|---|---|---|---|---|
| CAS Number | 588673-53-4 | Molecular Weight | 283.77700 | |
| Density | 1.34g/cm3 | Boiling Point | 376.4ºC at 760 mmHg | |
| Molecular Formula | C12H14ClN3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.4ºC | |
| Name | 3-[1-(4-chloro-2-methylphenoxy)ethyl]-4-methyl-1H-1,2,4-triazole-5-thione |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 376.4ºC at 760 mmHg |
| Molecular Formula | C12H14ClN3OS |
| Molecular Weight | 283.77700 |
| Flash Point | 181.4ºC |
| Exact Mass | 283.05500 |
| PSA | 78.74000 |
| LogP | 3.20560 |
| Index of Refraction | 1.635 |
| InChIKey | FPEPBEYRTZLFDV-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)ccc1OC(C)c1n[nH]c(=S)n1C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |