ART-CHEM-BB B018142
Modify Date: 2024-01-29 23:34:31
ART-CHEM-BB B018142 structure
|
Common Name | ART-CHEM-BB B018142 | ||
|---|---|---|---|---|
| CAS Number | 588673-44-3 | Molecular Weight | 249.33200 | |
| Density | 1.23g/cm3 | Boiling Point | 350.3ºC at 760 mmHg | |
| Molecular Formula | C12H15N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.7ºC | |
| Name | 4-methyl-3-[1-(4-methylphenoxy)ethyl]-1H-1,2,4-triazole-5-thione |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 350.3ºC at 760 mmHg |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.33200 |
| Flash Point | 165.7ºC |
| Exact Mass | 249.09400 |
| PSA | 78.74000 |
| LogP | 2.55220 |
| Index of Refraction | 1.621 |
| InChIKey | IJHSPALLUGDQLM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OC(C)c2n[nH]c(=S)n2C)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |