4-cyano-4'-ethoxybiphenyl structure
|
Common Name | 4-cyano-4'-ethoxybiphenyl | ||
|---|---|---|---|---|
| CAS Number | 58743-78-5 | Molecular Weight | 223.270 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 380.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C15H13NO | Melting Point | 105-108°C | |
| MSDS | N/A | Flash Point | 160.4±19.8 °C | |
| Name | 4-(4-ethoxyphenyl)benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 380.8±35.0 °C at 760 mmHg |
| Melting Point | 105-108°C |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.270 |
| Flash Point | 160.4±19.8 °C |
| Exact Mass | 223.099716 |
| PSA | 33.02000 |
| LogP | 3.64 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | VETJRGXWDLHERN-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(-c2ccc(C#N)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2926909090 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (1,1'-Biphenyl)-4-carbonitrile,4'-ethoxy |
| (1,1'-Biphenyl)-4-carbonitrile, 4'-ethoxy- |
| 4'-Ethoxybiphenyl-4-carbonitrile |
| MFCD01218033 |
| 4'-Ethoxy-4-biphenylcarbonitrile |
| 4'-Ethoxy(1,1'-biphenyl)-4-carbonitrile |
| 4'-Ethoxy-4-cyanobiphenyl |
| [1,1'-Biphenyl]-4-carbonitrile, 4'-ethoxy- |
| 4-ethyloxy-4'-cyanobiphenyl |
| 4-(4-ethoxyphenyl)benzenecarbonitrile |
| 4-cyano-4'-ethoxybiphenyl |
| EINECS 261-417-3 |