di-(Thiobenzoyl) disulfide structure
|
Common Name | di-(Thiobenzoyl) disulfide | ||
|---|---|---|---|---|
| CAS Number | 5873-93-8 | Molecular Weight | 306.48900 | |
| Density | 1.367 g/cm3 | Boiling Point | 446.8ºC at 760 mmHg | |
| Molecular Formula | C14H10S4 | Melting Point | 91 °C | |
| MSDS | Chinese USA | Flash Point | 224ºC | |
| Symbol |
GHS09 |
Signal Word | Warning | |
| Name | Diphenyldithioperoxyanhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.367 g/cm3 |
|---|---|
| Boiling Point | 446.8ºC at 760 mmHg |
| Melting Point | 91 °C |
| Molecular Formula | C14H10S4 |
| Molecular Weight | 306.48900 |
| Flash Point | 224ºC |
| Exact Mass | 305.96700 |
| PSA | 114.78000 |
| LogP | 5.11920 |
| InChIKey | LWGLGSPYKZTZBM-UHFFFAOYSA-N |
| SMILES | S=C(SSC(=S)c1ccccc1)c1ccccc1 |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
|
Universal (switchable) RAFT agents.
Material Matters 5 , 2, (2010) The polymerization of most monomers that are polymerizable by radical polymerization can be controlled by the reversible addition-fragmentation chain transfer (RAFT) process. However, it is usually re... |
|
|
RAFT Agent Design and Synthesis Keddie, D. J.; et al.
Macromolecules 45 , 5321-5342, (2012)
|
| diphenacylsulfone |
| dithiobenzoic acid disulfide |
| 1,1'-diphenyl-2,2'-sulfonyl-bis-ethanone |
| bis(phenacyl)sulfone |
| bis(dithiobenzoyl) disulfide |
| bis(benzoylmethyl)sulfone |
| bis(benzenethiocarbonyl) disulfide |
| bis(thiocarbonyl) disulfide |
| Diphenacyl-sulfon |
| bis(thiobenzoyl) disulfide |
| Diphenacyl sulphone |
| bis(thiobenzoyl) disulphide |
| bis(phenyl thiocarbonyl)disulfide |
| 2,2'-sulfonylbis(1-phenylethanone) |