H-Thr(tBu)-OtBu.AcOH structure
|
Common Name | H-Thr(tBu)-OtBu.AcOH | ||
|---|---|---|---|---|
| CAS Number | 5854-77-3 | Molecular Weight | 291.38400 | |
| Density | N/A | Boiling Point | 406.3ºC at 760 mmHg | |
| Molecular Formula | C14H29NO5 | Melting Point | 59-61ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-Thr(tBu)-OtBu.AcOHO-tert-Butyl-L-threonine tert-butyl ester acetate salt is a threonine derivative[1]. |
| Name | O,O-Di-tert-butyl-L-threonine acetate |
|---|---|
| Synonym | More Synonyms |
| Description | O-tert-Butyl-L-threonine tert-butyl ester acetate salt is a threonine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Boiling Point | 406.3ºC at 760 mmHg |
|---|---|
| Melting Point | 59-61ºC |
| Molecular Formula | C14H29NO5 |
| Molecular Weight | 291.38400 |
| Exact Mass | 291.20500 |
| PSA | 98.85000 |
| LogP | 2.65020 |
| InChIKey | BGAUVMFJRASONL-RJUBDTSPSA-N |
| SMILES | CC(=O)O.CC(OC(C)(C)C)C(N)C(=O)OC(C)(C)C |
| MFCD00145051 |