dimethyl 2-[(3,4-dimethoxyphenyl)methylidene]propanedioate
Modify Date: 2025-11-29 19:57:18
![dimethyl 2-[(3,4-dimethoxyphenyl)methylidene]propanedioate Structure](https://image.chemsrc.com/caspic/041/5854-19-3.png)
dimethyl 2-[(3,4-dimethoxyphenyl)methylidene]propanedioate structure
|
Common Name | dimethyl 2-[(3,4-dimethoxyphenyl)methylidene]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 5854-19-3 | Molecular Weight | 280.27300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 2-[(3,4-dimethoxyphenyl)methylidene]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16O6 |
|---|---|
| Molecular Weight | 280.27300 |
| Exact Mass | 280.09500 |
| PSA | 71.06000 |
| LogP | 1.43320 |
| InChIKey | ZGMOERDBDSTKFT-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=Cc1ccc(OC)c(OC)c1)C(=O)OC |
| HS Code | 2918990090 |
|---|
|
~94%
dimethyl 2-[(3,... CAS#:5854-19-3 |
| Literature: Buckley, Thomas F.; Rapoport, Henry Journal of the American Chemical Society, 1980 , vol. 102, # 9 p. 3056 - 3062 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 2-(3,4-dimethoxyphenyl)methylidenemalonate |
| dimethyl 2-(3,4-dimethoxybenzylidene)malonate |
| dimethyl 3,4-dimethoxybenzalmalonate |
| dimethyl 3,4-dimethoxybenzylidenemalonate |
| Propanedioic acid,[(3,4-dimethoxyphenyl)methylene]-,dimethyl ester |