α,β-Trehalose structure
|
Common Name | α,β-Trehalose | ||
|---|---|---|---|---|
| CAS Number | 585-91-1 | Molecular Weight | 342.29600 | |
| Density | 1.768g/cm3 | Boiling Point | 675.384ºC at 760 mmHg | |
| Molecular Formula | C12H22O11 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 362.259ºC | |
Use of α,β-Trehaloseα,β-Trehalose is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | Neotrehalose |
|---|---|
| Synonym | More Synonyms |
| Description | α,β-Trehalose is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.768g/cm3 |
|---|---|
| Boiling Point | 675.384ºC at 760 mmHg |
| Molecular Formula | C12H22O11 |
| Molecular Weight | 342.29600 |
| Flash Point | 362.259ºC |
| Exact Mass | 342.11600 |
| PSA | 189.53000 |
| Index of Refraction | 1.652 |
| InChIKey | HDTRYLNUVZCQOY-BTLHAWITSA-N |
| SMILES | OCC1OC(OC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| neothramycin B |
| Neothramycin A |
| MC-916-A |
| Antibiotic MC-916-A |
| D-trehalose |