N-[(3,4-dimethoxyphenyl)carbamoyl]acetamide structure
|
Common Name | N-[(3,4-dimethoxyphenyl)carbamoyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 58487-63-1 | Molecular Weight | 238.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(3,4-dimethoxyphenyl)carbamoyl]acetamide |
|---|
| Molecular Formula | C11H14N2O4 |
|---|---|
| Molecular Weight | 238.24000 |
| Exact Mass | 238.09500 |
| PSA | 83.64000 |
| LogP | 2.22570 |
| InChIKey | ABABSOZVCWZYCR-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)NC(C)=O)cc1OC |
|
~%
N-[(3,4-dimetho... CAS#:58487-63-1 |
| Literature: Fetscher; Bogert Journal of Organic Chemistry, 1939 , vol. 4, p. 71,80 |
|
~%
N-[(3,4-dimetho... CAS#:58487-63-1 |
| Literature: Fetscher; Bogert Journal of Organic Chemistry, 1939 , vol. 4, p. 71,80 |