N-cyclohexyl-3-methyl-4-phenylbut-3-enamide
Modify Date: 2025-09-26 16:50:10
N-cyclohexyl-3-methyl-4-phenylbut-3-enamide structure
|
Common Name | N-cyclohexyl-3-methyl-4-phenylbut-3-enamide | ||
|---|---|---|---|---|
| CAS Number | 58458-53-0 | Molecular Weight | 257.37100 | |
| Density | 1.02g/cm3 | Boiling Point | 456.2ºC at 760 mmHg | |
| Molecular Formula | C17H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.6ºC | |
| Name | N-cyclohexyl-3-methyl-4-phenylbut-3-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 456.2ºC at 760 mmHg |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.37100 |
| Flash Point | 277.6ºC |
| Exact Mass | 257.17800 |
| PSA | 32.59000 |
| LogP | 4.76920 |
| Index of Refraction | 1.544 |
| InChIKey | FUWUVSZMCJVUAN-UHFFFAOYSA-N |
| SMILES | CC(=Cc1ccccc1)CC(=O)NC1CCCCC1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Cyclohexyl-3-methyl-4-phenyl-3-butenamide |
| 3-Methyl-4-phenyl-3-butensaeure-cyclohexylamid |