3-methyl-4-phenyl-3-butenoic acid diethylamide structure
|
Common Name | 3-methyl-4-phenyl-3-butenoic acid diethylamide | ||
|---|---|---|---|---|
| CAS Number | 58458-55-2 | Molecular Weight | 231.33300 | |
| Density | 0.99g/cm3 | Boiling Point | 362.8ºC at 760 mmHg | |
| Molecular Formula | C15H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.4ºC | |
| Name | N,N-diethyl-3-methyl-4-phenylbut-3-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 362.8ºC at 760 mmHg |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.33300 |
| Flash Point | 159.4ºC |
| Exact Mass | 231.16200 |
| PSA | 20.31000 |
| LogP | 3.34840 |
| Index of Refraction | 1.542 |
| InChIKey | VSHBKFZWSYFCND-ACCUITESSA-N |
| SMILES | CCN(CC)C(=O)CC(C)=Cc1ccccc1 |
|
~%
3-methyl-4-phen... CAS#:58458-55-2 |
| Literature: Istituto Biochimico Italiano di Loredana Lorenzini S.a.s. Patent: US4053635 A1, 1977 ; |
| 3-Butenamide,N,N-diethyl-3-methyl-4-phenyl |
| diethylamide of 3-methyl-4-phenyl-3-butenoic acid |
| b-Benzalbutyrate diethylamide |