1H-Pyrrolo[3,2-h]quinoline-2-carboxylic acid structure
|
Common Name | 1H-Pyrrolo[3,2-h]quinoline-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 58457-37-7 | Molecular Weight | 212.20400 | |
| Density | 1.497g/cm3 | Boiling Point | 536.6ºC at 760 mmHg | |
| Molecular Formula | C12H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.3ºC | |
| Name | 1H-Pyrrolo[3,2-h]quinoline-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.497g/cm3 |
|---|---|
| Boiling Point | 536.6ºC at 760 mmHg |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.20400 |
| Flash Point | 278.3ºC |
| Exact Mass | 212.05900 |
| PSA | 65.98000 |
| LogP | 2.41430 |
| Index of Refraction | 1.814 |
| InChIKey | NKRJTXAQMCUSEC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc2ccc3cccnc3c2[nH]1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
1H-Pyrrolo[3,2-... CAS#:58457-37-7 |
| Literature: Farmaco, , vol. 47, # 12 p. 1513 - 1528 |
|
~%
1H-Pyrrolo[3,2-... CAS#:58457-37-7 |
| Literature: Helvetica Chimica Acta, , vol. 36, p. 941,948 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Pyrrolo[3,2-h]chinolin-2-carbonsaeure |
| 2-carboxy-1H-pyrrolo<3,2-h>quinoline |
| 1H-Pyrrolo(3,2-h)quinoline-2-carboxylic acid |
| pyrrolo[3,2-h]quinoline-2-carboxylic acid |
| 1H-Pyrrolo<3,2-h>chinolyl-2-carbonsaeure |