2,2,3,4,4,4-HEXAFLUORO-1,1-DIMETHYLBUTANOL structure
|
Common Name | 2,2,3,4,4,4-HEXAFLUORO-1,1-DIMETHYLBUTANOL | ||
|---|---|---|---|---|
| CAS Number | 58380-92-0 | Molecular Weight | 210.11800 | |
| Density | 1.327g/cm3 | Boiling Point | 126.843ºC at 760 mmHg | |
| Molecular Formula | C6H8F6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 30.514ºC | |
| Name | 3,3,4,5,5,5-hexafluoro-2-methylpentan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 126.843ºC at 760 mmHg |
| Molecular Formula | C6H8F6O |
| Molecular Weight | 210.11800 |
| Flash Point | 30.514ºC |
| Exact Mass | 210.04800 |
| PSA | 20.23000 |
| LogP | 2.29300 |
| Index of Refraction | 1.329 |
| InChIKey | AHOBFJZDSQJNCO-UHFFFAOYSA-N |
| SMILES | CC(C)(O)C(F)(F)C(F)C(F)(F)F |
|
~89%
2,2,3,4,4,4-HEX... CAS#:58380-92-0 |
| Literature: Il'in; Bakhmutov; Furin; Pokrovskii Russian Journal of Applied Chemistry, 2007 , vol. 80, # 3 p. 405 - 418 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,2,3,4,4,4-hexafluoro-1,1-dimethylbutanol |
| 2-Pentanol,3,3,4,5,5,5-hexafluoro-2-methyl |
| 3,3,4,5,5,5-hexafluoro-2-methyl-pentan-2-ol |
| 2-Methyl-3,3,4,5,5,5-hexafluor-pentanol-2 |