1-Benzyl-6,7-dimethoxy-2-methyl-2.lambda.~5~-isoquinoline
Modify Date: 2024-01-07 17:26:51
1-Benzyl-6,7-dimethoxy-2-methyl-2.lambda.~5~-isoquinoline structure
|
Common Name | 1-Benzyl-6,7-dimethoxy-2-methyl-2.lambda.~5~-isoquinoline | ||
|---|---|---|---|---|
| CAS Number | 5833-04-5 | Molecular Weight | 421.27200 | |
| Density | 1.106g/cm3 | Boiling Point | 451.6ºC at 760 mmHg | |
| Molecular Formula | C19H20INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.7ºC | |
| Name | 1-benzyl-6,7-dimethoxy-2-methylisoquinolin-2-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 451.6ºC at 760 mmHg |
| Molecular Formula | C19H20INO2 |
| Molecular Weight | 421.27200 |
| Flash Point | 160.7ºC |
| Exact Mass | 421.05400 |
| PSA | 22.34000 |
| LogP | 0.27630 |
| Index of Refraction | 1.579 |
| InChIKey | IABYMOPVGIZIMO-UHFFFAOYSA-N |
| SMILES | COc1cc2cc[n+](C)c(Cc3ccccc3)c2cc1OC |
| HS Code | 2933499090 |
|---|
|
~%
1-Benzyl-6,7-di... CAS#:5833-04-5 |
| Literature: Decker; Pschorr Chemische Berichte, 1904 , vol. 37, p. 3401 |
|
~%
1-Benzyl-6,7-di... CAS#:5833-04-5 |
| Literature: Decker; Pschorr Chemische Berichte, 1904 , vol. 37, p. 3401 |
|
~%
1-Benzyl-6,7-di... CAS#:5833-04-5 |
| Literature: Decker; Pschorr Chemische Berichte, 1904 , vol. 37, p. 3401 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Benzyl-6,7-dimethoxy-2-methyl-isochinolinium,Jodid |
| 6,7-Dimethoxy-2-methyl-1-benzyl-isochinolinium-jodid |
| 1-benzyl-6,7-dimethoxy-2-methyl-isoquinolinium,iodide |