triethyl 2,2-dichloro-2-phosphonoacetate structure
|
Common Name | triethyl 2,2-dichloro-2-phosphonoacetate | ||
|---|---|---|---|---|
| CAS Number | 5823-12-1 | Molecular Weight | 293.08100 | |
| Density | 1.289 g/mL at 25ºC(lit.) | Boiling Point | 84-86ºC0.01 mm Hg(lit.) | |
| Molecular Formula | C8H15Cl2O5P | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | ethyl 2,2-dichloro-2-diethoxyphosphorylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 84-86ºC0.01 mm Hg(lit.) |
| Molecular Formula | C8H15Cl2O5P |
| Molecular Weight | 293.08100 |
| Flash Point | >230 °F |
| Exact Mass | 292.00300 |
| PSA | 71.64000 |
| LogP | 2.94700 |
| Index of Refraction | n20/D 1.456(lit.) |
| InChIKey | PNIZABWIGNVQCB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cl)(Cl)P(=O)(OCC)OCC |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~96%
triethyl 2,2-di... CAS#:5823-12-1 |
| Literature: McKenna, Charles E.; Khawli, Leslie A. Journal of Organic Chemistry, 1986 , vol. 51, # 26 p. 5467 - 5471 |
| ethyl 2,2-dichloro-2-diethylphosphonoacetate |
| 2,2-Dichlor-2-diaethylphosphonoessigsaeureaethylester |
| Triethyl dichloromethylphosphonoacetate |
| MFCD00192517 |
| Ethoxycarbonyldichlormethyl-phosphonsaeure-diethylester |
| Triethyl 2,2-dichloro-2-phosphonoacetate |
| triethyl dichlorophosphonoacetate |
| 2-Diaethoxyphosphinyl-dichloressigsaeureaethylester |
| triethyl 2,2-dichlorophosphonoacetate |