ethyl 5-(2-methoxynaphthalen-1-yl)-7-methyl-3-oxo-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate structure
|
Common Name | ethyl 5-(2-methoxynaphthalen-1-yl)-7-methyl-3-oxo-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5820-23-5 | Molecular Weight | 618.62200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H25F3N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 5-(2-methoxynaphthalen-1-yl)-7-methyl-3-oxo-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C33H25F3N2O5S |
|---|---|
| Molecular Weight | 618.62200 |
| Exact Mass | 618.14400 |
| PSA | 111.27000 |
| LogP | 5.67450 |
| InChIKey | UJRMXRYLBNUJPY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C)N=c2sc(=Cc3ccc(-c4cccc(C(F)(F)F)c4)o3)c(=O)n2C1c1c(OC)ccc2ccccc12 |
|
~%
ethyl 5-(2-meth... CAS#:5820-23-5 |
| Literature: Bartz; Miller; Adams Journal of the American Chemical Society, 1935 , vol. 57, p. 371,372, 374 |
| 4-Chlor-1-methallyloxy-benzol |